C7H12N2O3 — CID 106164737
N-(3-amino-2-hydroxy-3-oxopropyl)but-3-enamide (PubChem CID 106164737) has the molecular formula C7H12N2O3 and a molecular weight of 172.18 g/mol. Its IUPAC name is N-(3-amino-2-hydroxy-3-oxopropyl)but-3-enamide.
| Compound Name | N-(3-amino-2-hydroxy-3-oxopropyl)but-3-enamide |
|---|---|
| PubChem CID | 106164737 |
| Molecular Formula | C7H12N2O3 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.08 |
| IUPAC Name | N-(3-amino-2-hydroxy-3-oxopropyl)but-3-enamide |
| SMILES | C=CCC(=O)NCC(O)C(N)=O |
| InChI | InChI=1S/C7H12N2O3/c1-2-3-6(11)9-4-5(10)7(8)12/h2,5,10H,1,3-4H2,(H2,8,12)(H,9,11) |
| InChIKey | YMBOCFDVGADLRD-UHFFFAOYSA-N |
| XLogP | -1.48 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|