C8H10N4O3 — CID 106164807
N-(3-amino-2-hydroxy-3-oxopropyl)pyridazine-4-carboxamide (PubChem CID 106164807) has the molecular formula C8H10N4O3 and a molecular weight of 210.19 g/mol. Its IUPAC name is N-(3-amino-2-hydroxy-3-oxopropyl)pyridazine-4-carboxamide.
| Compound Name | N-(3-amino-2-hydroxy-3-oxopropyl)pyridazine-4-carboxamide |
|---|---|
| PubChem CID | 106164807 |
| Molecular Formula | C8H10N4O3 |
| Molecular Weight | 210.19 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | N-(3-amino-2-hydroxy-3-oxopropyl)pyridazine-4-carboxamide |
| SMILES | NC(=O)C(O)CNC(=O)c1ccnnc1 |
| InChI | InChI=1S/C8H10N4O3/c9-7(14)6(13)4-10-8(15)5-1-2-11-12-3-5/h1-3,6,13H,4H2,(H2,9,14)(H,10,15) |
| InChIKey | JLVRFRYQYWXWAL-UHFFFAOYSA-N |
| XLogP | -1.95 |
| TPSA | 118.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.19 |
| LogP ≤ 5 | -1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |