C11H16N4O3 — CID 114152484
N-(3-amino-2-hydroxy-3-oxopropyl)-2-(dimethylamino)pyridine-4-carboxamide (PubChem CID 114152484) has the molecular formula C11H16N4O3 and a molecular weight of 252.27 g/mol. Its IUPAC name is N-(3-amino-2-hydroxy-3-oxopropyl)-2-(dimethylamino)pyridine-4-carboxamide.
| Compound Name | N-(3-amino-2-hydroxy-3-oxopropyl)-2-(dimethylamino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 114152484 |
| Molecular Formula | C11H16N4O3 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | N-(3-amino-2-hydroxy-3-oxopropyl)-2-(dimethylamino)pyridine-4-carboxamide |
| SMILES | CN(C)c1cc(C(=O)NCC(O)C(N)=O)ccn1 |
| InChI | InChI=1S/C11H16N4O3/c1-15(2)9-5-7(3-4-13-9)11(18)14-6-8(16)10(12)17/h3-5,8,16H,6H2,1-2H3,(H2,12,17)(H,14,18) |
| InChIKey | KHSUPYUTBBNJBY-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 108.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |