C12H16N4O4 — CID 106165291
3-[[2-(carbamoylamino)-2-phenylacetyl]amino]-2-hydroxypropanamide (PubChem CID 106165291) has the molecular formula C12H16N4O4 and a molecular weight of 280.28 g/mol. Its IUPAC name is 3-[[2-(carbamoylamino)-2-phenylacetyl]amino]-2-hydroxypropanamide.
| Compound Name | 3-[[2-(carbamoylamino)-2-phenylacetyl]amino]-2-hydroxypropanamide |
|---|---|
| PubChem CID | 106165291 |
| Molecular Formula | C12H16N4O4 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 3-[[2-(carbamoylamino)-2-phenylacetyl]amino]-2-hydroxypropanamide |
| SMILES | NC(=O)NC(C(=O)NCC(O)C(N)=O)c1ccccc1 |
| InChI | InChI=1S/C12H16N4O4/c13-10(18)8(17)6-15-11(19)9(16-12(14)20)7-4-2-1-3-5-7/h1-5,8-9,17H,6H2,(H2,13,18)(H,15,19)(H3,14,16,20) |
| InChIKey | UTDGXSHTHCDDPH-UHFFFAOYSA-N |
| XLogP | -1.64 |
| TPSA | 147.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |