C13H19N3O3 — CID 106175749
3-amino-N-(3-amino-2-hydroxy-3-oxopropyl)-2-methyl-3-phenylpropanamide (PubChem CID 106175749) has the molecular formula C13H19N3O3 and a molecular weight of 265.31 g/mol. Its IUPAC name is 3-amino-N-(3-amino-2-hydroxy-3-oxopropyl)-2-methyl-3-phenylpropanamide.
| Compound Name | 3-amino-N-(3-amino-2-hydroxy-3-oxopropyl)-2-methyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 106175749 |
| Molecular Formula | C13H19N3O3 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | 3-amino-N-(3-amino-2-hydroxy-3-oxopropyl)-2-methyl-3-phenylpropanamide |
| SMILES | CC(C(=O)NCC(O)C(N)=O)C(N)c1ccccc1 |
| InChI | InChI=1S/C13H19N3O3/c1-8(11(14)9-5-3-2-4-6-9)13(19)16-7-10(17)12(15)18/h2-6,8,10-11,17H,7,14H2,1H3,(H2,15,18)(H,16,19) |
| InChIKey | GLUNBOCXBMWUEF-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 118.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |