About 3-N-cinnolin-4-yl-3-methylpentane-1,3-diamine
3-N-cinnolin-4-yl-3-methylpentane-1,3-diamine (PubChem CID 106166028) has the molecular formula C14H20N4
and a molecular weight of 244.34 g/mol. Its IUPAC name is 3-N-cinnolin-4-yl-3-methylpentane-1,3-diamine.
Molecular Properties
| Compound Name | 3-N-cinnolin-4-yl-3-methylpentane-1,3-diamine |
| PubChem CID | 106166028 |
| Molecular Formula | C14H20N4 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | 3-N-cinnolin-4-yl-3-methylpentane-1,3-diamine |
| SMILES | CCC(C)(CCN)Nc1cnnc2ccccc12 |
| InChI | InChI=1S/C14H20N4/c1-3-14(2,8-9-15)17-13-10-16-18-12-7-5-4-6-11(12)13/h4-7,10H,3,8-9,15H2,1-2H3,(H,17,18) |
| InChIKey | AAULGYKINRCLDK-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-N-cinnolin-4-yl-3-methylpentane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N-cinnolin-4-yl-3-methylpentane-1,3-diamine?
The IUPAC name of 3-N-cinnolin-4-yl-3-methylpentane-1,3-diamine (CID 106166028) is 3-N-cinnolin-4-yl-3-methylpentane-1,3-diamine.
What is the SMILES notation for 3-N-cinnolin-4-yl-3-methylpentane-1,3-diamine?
The canonical SMILES for 3-N-cinnolin-4-yl-3-methylpentane-1,3-diamine is CCC(C)(CCN)Nc1cnnc2ccccc12.
What is the InChIKey of 3-N-cinnolin-4-yl-3-methylpentane-1,3-diamine?
The InChIKey is AAULGYKINRCLDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N4/c1-3-14(2,8-9-15)17-13-10-16-18-12-7-5-4-6-11(12)13/h4-7,10H,3,8-9,15H2,1-2H3,(H,17,18).
What are the key properties of 3-N-cinnolin-4-yl-3-methylpentane-1,3-diamine?
3-N-cinnolin-4-yl-3-methylpentane-1,3-diamine has a molecular weight of 244.34 g/mol, XLogP of 2.56, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N-cinnolin-4-yl-3-methylpentane-1,3-diamine is sourced from PubChem (CID 106166028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).