C13H14F3N3 — CID 115520682
N-(5,5,5-trifluoropentyl)cinnolin-4-amine (PubChem CID 115520682) has the molecular formula C13H14F3N3 and a molecular weight of 269.27 g/mol. Its IUPAC name is N-(5,5,5-trifluoropentyl)cinnolin-4-amine.
| Compound Name | N-(5,5,5-trifluoropentyl)cinnolin-4-amine |
|---|---|
| PubChem CID | 115520682 |
| Molecular Formula | C13H14F3N3 |
| Molecular Weight | 269.27 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | N-(5,5,5-trifluoropentyl)cinnolin-4-amine |
| SMILES | FC(F)(F)CCCCNc1cnnc2ccccc12 |
| InChI | InChI=1S/C13H14F3N3/c14-13(15,16)7-3-4-8-17-12-9-18-19-11-6-2-1-5-10(11)12/h1-2,5-6,9H,3-4,7-8H2,(H,17,19) |
| InChIKey | JSTFXKGUSLFHRM-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.27 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|