C12H13F6NO3 — CID 10616622
4,4,4-trifluoro-2,2-dimethyl-1-[2-(2,2,2-trifluoroacetyl)pyrrolidin-1-yl]butane-1,3-dione (PubChem CID 10616622) has the molecular formula C12H13F6NO3 and a molecular weight of 333.23 g/mol. Its IUPAC name is 4,4,4-trifluoro-2,2-dimethyl-1-[2-(2,2,2-trifluoroacetyl)pyrrolidin-1-yl]butane-1,3-dione.
| Compound Name | 4,4,4-trifluoro-2,2-dimethyl-1-[2-(2,2,2-trifluoroacetyl)pyrrolidin-1-yl]butane-1,3-dione |
|---|---|
| PubChem CID | 10616622 |
| Molecular Formula | C12H13F6NO3 |
| Molecular Weight | 333.23 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | 4,4,4-trifluoro-2,2-dimethyl-1-[2-(2,2,2-trifluoroacetyl)pyrrolidin-1-yl]butane-1,3-dione |
| SMILES | CC(C)(C(=O)N1CCCC1C(=O)C(F)(F)F)C(=O)C(F)(F)F |
| InChI | InChI=1S/C12H13F6NO3/c1-10(2,8(21)12(16,17)18)9(22)19-5-3-4-6(19)7(20)11(13,14)15/h6H,3-5H2,1-2H3 |
| InChIKey | BSTIUOHUWYIXJZ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.23 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|