C16H19ClN2O2 — CID 106166848
4-chloro-N-(1-hydroxy-3-methylpentan-3-yl)quinoline-2-carboxamide (PubChem CID 106166848) has the molecular formula C16H19ClN2O2 and a molecular weight of 306.79 g/mol. Its IUPAC name is 4-chloro-N-(1-hydroxy-3-methylpentan-3-yl)quinoline-2-carboxamide.
| Compound Name | 4-chloro-N-(1-hydroxy-3-methylpentan-3-yl)quinoline-2-carboxamide |
|---|---|
| PubChem CID | 106166848 |
| Molecular Formula | C16H19ClN2O2 |
| Molecular Weight | 306.79 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 4-chloro-N-(1-hydroxy-3-methylpentan-3-yl)quinoline-2-carboxamide |
| SMILES | CCC(C)(CCO)NC(=O)c1cc(Cl)c2ccccc2n1 |
| InChI | InChI=1S/C16H19ClN2O2/c1-3-16(2,8-9-20)19-15(21)14-10-12(17)11-6-4-5-7-13(11)18-14/h4-7,10,20H,3,8-9H2,1-2H3,(H,19,21) |
| InChIKey | KGCPZVNIKRFVHL-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.79 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |