C16H21N3O2 — CID 106167148
N-(1-hydroxy-3-methylpentan-3-yl)-3-phenylimidazole-4-carboxamide (PubChem CID 106167148) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is N-(1-hydroxy-3-methylpentan-3-yl)-3-phenylimidazole-4-carboxamide.
| Compound Name | N-(1-hydroxy-3-methylpentan-3-yl)-3-phenylimidazole-4-carboxamide |
|---|---|
| PubChem CID | 106167148 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | N-(1-hydroxy-3-methylpentan-3-yl)-3-phenylimidazole-4-carboxamide |
| SMILES | CCC(C)(CCO)NC(=O)c1cncn1-c1ccccc1 |
| InChI | InChI=1S/C16H21N3O2/c1-3-16(2,9-10-20)18-15(21)14-11-17-12-19(14)13-7-5-4-6-8-13/h4-8,11-12,20H,3,9-10H2,1-2H3,(H,18,21) |
| InChIKey | NXLGZNZXGMBDOT-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |