C11H14N2O4S2 — CID 106168048
5-[2-(cyclopenten-1-yl)ethylsulfamoyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 106168048) has the molecular formula C11H14N2O4S2 and a molecular weight of 302.38 g/mol. Its IUPAC name is 5-[2-(cyclopenten-1-yl)ethylsulfamoyl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 5-[2-(cyclopenten-1-yl)ethylsulfamoyl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 106168048 |
| Molecular Formula | C11H14N2O4S2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.04 |
| IUPAC Name | 5-[2-(cyclopenten-1-yl)ethylsulfamoyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(O)c1ncsc1S(=O)(=O)NCCC1=CCCC1 |
| InChI | InChI=1S/C11H14N2O4S2/c14-10(15)9-11(18-7-12-9)19(16,17)13-6-5-8-3-1-2-4-8/h3,7,13H,1-2,4-6H2,(H,14,15) |
| InChIKey | RTCLNPIYSAPEFN-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|