C11H15N3O6S — CID 106168338
4-[(3-amino-2-hydroxy-3-oxopropyl)sulfamoyl]-1-cyclopropylpyrrole-2-carboxylic acid (PubChem CID 106168338) has the molecular formula C11H15N3O6S and a molecular weight of 317.32 g/mol. Its IUPAC name is 4-[(3-amino-2-hydroxy-3-oxopropyl)sulfamoyl]-1-cyclopropylpyrrole-2-carboxylic acid.
| Compound Name | 4-[(3-amino-2-hydroxy-3-oxopropyl)sulfamoyl]-1-cyclopropylpyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 106168338 |
| Molecular Formula | C11H15N3O6S |
| Molecular Weight | 317.32 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | 4-[(3-amino-2-hydroxy-3-oxopropyl)sulfamoyl]-1-cyclopropylpyrrole-2-carboxylic acid |
| SMILES | NC(=O)C(O)CNS(=O)(=O)c1cc(C(=O)O)n(C2CC2)c1 |
| InChI | InChI=1S/C11H15N3O6S/c12-10(16)9(15)4-13-21(19,20)7-3-8(11(17)18)14(5-7)6-1-2-6/h3,5-6,9,13,15H,1-2,4H2,(H2,12,16)(H,17,18) |
| InChIKey | DKMJJVFNSLDCAK-UHFFFAOYSA-N |
| XLogP | -1.35 |
| TPSA | 151.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.32 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |