C12H17N3O5S — CID 43644658
1-cyclopropyl-4-[[2-(ethylamino)-2-oxoethyl]sulfamoyl]pyrrole-2-carboxylic acid (PubChem CID 43644658) has the molecular formula C12H17N3O5S and a molecular weight of 315.35 g/mol. Its IUPAC name is 1-cyclopropyl-4-[[2-(ethylamino)-2-oxoethyl]sulfamoyl]pyrrole-2-carboxylic acid.
| Compound Name | 1-cyclopropyl-4-[[2-(ethylamino)-2-oxoethyl]sulfamoyl]pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 43644658 |
| Molecular Formula | C12H17N3O5S |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 1-cyclopropyl-4-[[2-(ethylamino)-2-oxoethyl]sulfamoyl]pyrrole-2-carboxylic acid |
| SMILES | CCNC(=O)CNS(=O)(=O)c1cc(C(=O)O)n(C2CC2)c1 |
| InChI | InChI=1S/C12H17N3O5S/c1-2-13-11(16)6-14-21(19,20)9-5-10(12(17)18)15(7-9)8-3-4-8/h5,7-8,14H,2-4,6H2,1H3,(H,13,16)(H,17,18) |
| InChIKey | PXEBNQMGBZPVSN-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 117.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |