C13H13BrF5NO — CID 106168958
N-(1-bromo-3-methylpentan-3-yl)-2,3,4,5,6-pentafluorobenzamide (PubChem CID 106168958) has the molecular formula C13H13BrF5NO and a molecular weight of 374.15 g/mol. Its IUPAC name is N-(1-bromo-3-methylpentan-3-yl)-2,3,4,5,6-pentafluorobenzamide.
| Compound Name | N-(1-bromo-3-methylpentan-3-yl)-2,3,4,5,6-pentafluorobenzamide |
|---|---|
| PubChem CID | 106168958 |
| Molecular Formula | C13H13BrF5NO |
| Molecular Weight | 374.15 g/mol |
| Exact Mass | 373.01 |
| IUPAC Name | N-(1-bromo-3-methylpentan-3-yl)-2,3,4,5,6-pentafluorobenzamide |
| SMILES | CCC(C)(CCBr)NC(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C13H13BrF5NO/c1-3-13(2,4-5-14)20-12(21)6-7(15)9(17)11(19)10(18)8(6)16/h3-5H2,1-2H3,(H,20,21) |
| InChIKey | XPAHOXPZSXZJGB-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.15 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|