C12H24BrNO2 — CID 106169162
N-(1-bromo-3-methylpentan-3-yl)-2-[(2-methylpropan-2-yl)oxy]acetamide (PubChem CID 106169162) has the molecular formula C12H24BrNO2 and a molecular weight of 294.23 g/mol. Its IUPAC name is N-(1-bromo-3-methylpentan-3-yl)-2-[(2-methylpropan-2-yl)oxy]acetamide.
| Compound Name | N-(1-bromo-3-methylpentan-3-yl)-2-[(2-methylpropan-2-yl)oxy]acetamide |
|---|---|
| PubChem CID | 106169162 |
| Molecular Formula | C12H24BrNO2 |
| Molecular Weight | 294.23 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | N-(1-bromo-3-methylpentan-3-yl)-2-[(2-methylpropan-2-yl)oxy]acetamide |
| SMILES | CCC(C)(CCBr)NC(=O)COC(C)(C)C |
| InChI | InChI=1S/C12H24BrNO2/c1-6-12(5,7-8-13)14-10(15)9-16-11(2,3)4/h6-9H2,1-5H3,(H,14,15) |
| InChIKey | UEYRIFNMTJNMOE-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.23 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|