C10H17BrF3NO2 — CID 106169723
N-(1-bromo-3-methylpentan-3-yl)-2-(2,2,2-trifluoroethoxy)acetamide (PubChem CID 106169723) has the molecular formula C10H17BrF3NO2 and a molecular weight of 320.15 g/mol. Its IUPAC name is N-(1-bromo-3-methylpentan-3-yl)-2-(2,2,2-trifluoroethoxy)acetamide.
| Compound Name | N-(1-bromo-3-methylpentan-3-yl)-2-(2,2,2-trifluoroethoxy)acetamide |
|---|---|
| PubChem CID | 106169723 |
| Molecular Formula | C10H17BrF3NO2 |
| Molecular Weight | 320.15 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | N-(1-bromo-3-methylpentan-3-yl)-2-(2,2,2-trifluoroethoxy)acetamide |
| SMILES | CCC(C)(CCBr)NC(=O)COCC(F)(F)F |
| InChI | InChI=1S/C10H17BrF3NO2/c1-3-9(2,4-5-11)15-8(16)6-17-7-10(12,13)14/h3-7H2,1-2H3,(H,15,16) |
| InChIKey | QXBQUOMJFLCMBU-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.15 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|