C18H24BrNO — CID 106169448
N-(1-bromo-3-methylpentan-3-yl)-1a,2,3,7b-tetrahydro-1H-cyclopropa[a]naphthalene-1-carboxamide (PubChem CID 106169448) has the molecular formula C18H24BrNO and a molecular weight of 350.30 g/mol. Its IUPAC name is N-(1-bromo-3-methylpentan-3-yl)-1a,2,3,7b-tetrahydro-1H-cyclopropa[a]naphthalene-1-carboxamide.
| Compound Name | N-(1-bromo-3-methylpentan-3-yl)-1a,2,3,7b-tetrahydro-1H-cyclopropa[a]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 106169448 |
| Molecular Formula | C18H24BrNO |
| Molecular Weight | 350.30 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | N-(1-bromo-3-methylpentan-3-yl)-1a,2,3,7b-tetrahydro-1H-cyclopropa[a]naphthalene-1-carboxamide |
| SMILES | CCC(C)(CCBr)NC(=O)C1C2CCc3ccccc3C21 |
| InChI | InChI=1S/C18H24BrNO/c1-3-18(2,10-11-19)20-17(21)16-14-9-8-12-6-4-5-7-13(12)15(14)16/h4-7,14-16H,3,8-11H2,1-2H3,(H,20,21) |
| InChIKey | OJCRTHSXJMZOPU-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.30 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|