C18H24INO — CID 107848547
N-(6-iodohexyl)-1a,2,3,7b-tetrahydro-1H-cyclopropa[a]naphthalene-1-carboxamide (PubChem CID 107848547) has the molecular formula C18H24INO and a molecular weight of 397.30 g/mol. Its IUPAC name is N-(6-iodohexyl)-1a,2,3,7b-tetrahydro-1H-cyclopropa[a]naphthalene-1-carboxamide.
| Compound Name | N-(6-iodohexyl)-1a,2,3,7b-tetrahydro-1H-cyclopropa[a]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 107848547 |
| Molecular Formula | C18H24INO |
| Molecular Weight | 397.30 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | N-(6-iodohexyl)-1a,2,3,7b-tetrahydro-1H-cyclopropa[a]naphthalene-1-carboxamide |
| SMILES | O=C(NCCCCCCI)C1C2CCc3ccccc3C21 |
| InChI | InChI=1S/C18H24INO/c19-11-5-1-2-6-12-20-18(21)17-15-10-9-13-7-3-4-8-14(13)16(15)17/h3-4,7-8,15-17H,1-2,5-6,9-12H2,(H,20,21) |
| InChIKey | CUHKWZKFNLQHPP-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.30 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|