C9H14N2O3 — CID 106170390
2-hydroxy-3-[(5-methylfuran-2-yl)methylamino]propanamide (PubChem CID 106170390) has the molecular formula C9H14N2O3 and a molecular weight of 198.22 g/mol. Its IUPAC name is 2-hydroxy-3-[(5-methylfuran-2-yl)methylamino]propanamide.
| Compound Name | 2-hydroxy-3-[(5-methylfuran-2-yl)methylamino]propanamide |
|---|---|
| PubChem CID | 106170390 |
| Molecular Formula | C9H14N2O3 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | 2-hydroxy-3-[(5-methylfuran-2-yl)methylamino]propanamide |
| SMILES | Cc1ccc(CNCC(O)C(N)=O)o1 |
| InChI | InChI=1S/C9H14N2O3/c1-6-2-3-7(14-6)4-11-5-8(12)9(10)13/h2-3,8,11-12H,4-5H2,1H3,(H2,10,13) |
| InChIKey | YKUDLPKLMNWRMD-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |