C10H16N2O3S — CID 106170960
2-hydroxy-3-[[5-(methylsulfanylmethyl)furan-2-yl]methylamino]propanamide (PubChem CID 106170960) has the molecular formula C10H16N2O3S and a molecular weight of 244.32 g/mol. Its IUPAC name is 2-hydroxy-3-[[5-(methylsulfanylmethyl)furan-2-yl]methylamino]propanamide.
| Compound Name | 2-hydroxy-3-[[5-(methylsulfanylmethyl)furan-2-yl]methylamino]propanamide |
|---|---|
| PubChem CID | 106170960 |
| Molecular Formula | C10H16N2O3S |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | 2-hydroxy-3-[[5-(methylsulfanylmethyl)furan-2-yl]methylamino]propanamide |
| SMILES | CSCc1ccc(CNCC(O)C(N)=O)o1 |
| InChI | InChI=1S/C10H16N2O3S/c1-16-6-8-3-2-7(15-8)4-12-5-9(13)10(11)14/h2-3,9,12-13H,4-6H2,1H3,(H2,11,14) |
| InChIKey | JFYUGDOEFWCOEW-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |