C6H12F2N2O2 — CID 106170805
3-(1,1-difluoropropan-2-ylamino)-2-hydroxypropanamide (PubChem CID 106170805) has the molecular formula C6H12F2N2O2 and a molecular weight of 182.17 g/mol. Its IUPAC name is 3-(1,1-difluoropropan-2-ylamino)-2-hydroxypropanamide.
| Compound Name | 3-(1,1-difluoropropan-2-ylamino)-2-hydroxypropanamide |
|---|---|
| PubChem CID | 106170805 |
| Molecular Formula | C6H12F2N2O2 |
| Molecular Weight | 182.17 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 3-(1,1-difluoropropan-2-ylamino)-2-hydroxypropanamide |
| SMILES | CC(NCC(O)C(N)=O)C(F)F |
| InChI | InChI=1S/C6H12F2N2O2/c1-3(5(7)8)10-2-4(11)6(9)12/h3-5,10-11H,2H2,1H3,(H2,9,12) |
| InChIKey | DUVBYVZTDZVUIO-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.17 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |