C13H25N3O4 — CID 106171027
tert-butyl N-[3-[(3-amino-2-hydroxy-3-oxopropyl)amino]cyclopentyl]carbamate (PubChem CID 106171027) has the molecular formula C13H25N3O4 and a molecular weight of 287.36 g/mol. Its IUPAC name is tert-butyl N-[3-[(3-amino-2-hydroxy-3-oxopropyl)amino]cyclopentyl]carbamate.
| Compound Name | tert-butyl N-[3-[(3-amino-2-hydroxy-3-oxopropyl)amino]cyclopentyl]carbamate |
|---|---|
| PubChem CID | 106171027 |
| Molecular Formula | C13H25N3O4 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.18 |
| IUPAC Name | tert-butyl N-[3-[(3-amino-2-hydroxy-3-oxopropyl)amino]cyclopentyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCC(NCC(O)C(N)=O)C1 |
| InChI | InChI=1S/C13H25N3O4/c1-13(2,3)20-12(19)16-9-5-4-8(6-9)15-7-10(17)11(14)18/h8-10,15,17H,4-7H2,1-3H3,(H2,14,18)(H,16,19) |
| InChIKey | HQIUZKQFIVKMDO-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |