C12H25N3O4S — CID 79462833
tert-butyl N-[3-(2-sulfamoylethylamino)cyclopentyl]carbamate (PubChem CID 79462833) has the molecular formula C12H25N3O4S and a molecular weight of 307.42 g/mol. Its IUPAC name is tert-butyl N-[3-(2-sulfamoylethylamino)cyclopentyl]carbamate.
| Compound Name | tert-butyl N-[3-(2-sulfamoylethylamino)cyclopentyl]carbamate |
|---|---|
| PubChem CID | 79462833 |
| Molecular Formula | C12H25N3O4S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | tert-butyl N-[3-(2-sulfamoylethylamino)cyclopentyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCC(NCCS(N)(=O)=O)C1 |
| InChI | InChI=1S/C12H25N3O4S/c1-12(2,3)19-11(16)15-10-5-4-9(8-10)14-6-7-20(13,17)18/h9-10,14H,4-8H2,1-3H3,(H,15,16)(H2,13,17,18) |
| InChIKey | ZVSXSAFCNZBVMJ-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |