C15H28N2O4 — CID 79462183
methyl 3-[[3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]amino]propanoate (PubChem CID 79462183) has the molecular formula C15H28N2O4 and a molecular weight of 300.40 g/mol. Its IUPAC name is methyl 3-[[3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]amino]propanoate.
| Compound Name | methyl 3-[[3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]amino]propanoate |
|---|---|
| PubChem CID | 79462183 |
| Molecular Formula | C15H28N2O4 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | methyl 3-[[3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]amino]propanoate |
| SMILES | COC(=O)CCNC1CCCC(NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C15H28N2O4/c1-15(2,3)21-14(19)17-12-7-5-6-11(10-12)16-9-8-13(18)20-4/h11-12,16H,5-10H2,1-4H3,(H,17,19) |
| InChIKey | JTDZNAPUVDAXOH-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |