C12H22INO2 — CID 70036969
tert-butyl N-[3-(iodomethyl)cyclohexyl]carbamate (PubChem CID 70036969) has the molecular formula C12H22INO2 and a molecular weight of 339.22 g/mol. Its IUPAC name is tert-butyl N-[3-(iodomethyl)cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[3-(iodomethyl)cyclohexyl]carbamate |
|---|---|
| PubChem CID | 70036969 |
| Molecular Formula | C12H22INO2 |
| Molecular Weight | 339.22 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | tert-butyl N-[3-(iodomethyl)cyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCCC(CI)C1 |
| InChI | InChI=1S/C12H22INO2/c1-12(2,3)16-11(15)14-10-6-4-5-9(7-10)8-13/h9-10H,4-8H2,1-3H3,(H,14,15) |
| InChIKey | YNOAGMYOKVOHKN-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.22 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|