C11H16N2O4 — CID 106171414
2-hydroxy-3-[(2-hydroxy-4-methoxyphenyl)methylamino]propanamide (PubChem CID 106171414) has the molecular formula C11H16N2O4 and a molecular weight of 240.26 g/mol. Its IUPAC name is 2-hydroxy-3-[(2-hydroxy-4-methoxyphenyl)methylamino]propanamide.
| Compound Name | 2-hydroxy-3-[(2-hydroxy-4-methoxyphenyl)methylamino]propanamide |
|---|---|
| PubChem CID | 106171414 |
| Molecular Formula | C11H16N2O4 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | 2-hydroxy-3-[(2-hydroxy-4-methoxyphenyl)methylamino]propanamide |
| SMILES | COc1ccc(CNCC(O)C(N)=O)c(O)c1 |
| InChI | InChI=1S/C11H16N2O4/c1-17-8-3-2-7(9(14)4-8)5-13-6-10(15)11(12)16/h2-4,10,13-15H,5-6H2,1H3,(H2,12,16) |
| InChIKey | GNPDJEIHSSSQQQ-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|