C13H18N2O4 — CID 173193675
(2S)-N'-[(2-hydroxy-4-methoxyphenyl)methyl]-2-methylbutanediamide (PubChem CID 173193675) has the molecular formula C13H18N2O4 and a molecular weight of 266.30 g/mol. Its IUPAC name is (2S)-N'-[(2-hydroxy-4-methoxyphenyl)methyl]-2-methylbutanediamide.
| Compound Name | (2S)-N'-[(2-hydroxy-4-methoxyphenyl)methyl]-2-methylbutanediamide |
|---|---|
| PubChem CID | 173193675 |
| Molecular Formula | C13H18N2O4 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | (2S)-N'-[(2-hydroxy-4-methoxyphenyl)methyl]-2-methylbutanediamide |
| SMILES | COc1ccc(CNC(=O)C[C@H](C)C(N)=O)c(O)c1 |
| InChI | InChI=1S/C13H18N2O4/c1-8(13(14)18)5-12(17)15-7-9-3-4-10(19-2)6-11(9)16/h3-4,6,8,16H,5,7H2,1-2H3,(H2,14,18)(H,15,17)/t8-/m0/s1 |
| InChIKey | ATPRLVDNRKMRLX-QMMMGPOBSA-N |
| XLogP | 0.53 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|