C12H16F2N2O3 — CID 106171785
3-[1-[4-(difluoromethoxy)phenyl]ethylamino]-2-hydroxypropanamide (PubChem CID 106171785) has the molecular formula C12H16F2N2O3 and a molecular weight of 274.27 g/mol. Its IUPAC name is 3-[1-[4-(difluoromethoxy)phenyl]ethylamino]-2-hydroxypropanamide.
| Compound Name | 3-[1-[4-(difluoromethoxy)phenyl]ethylamino]-2-hydroxypropanamide |
|---|---|
| PubChem CID | 106171785 |
| Molecular Formula | C12H16F2N2O3 |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 3-[1-[4-(difluoromethoxy)phenyl]ethylamino]-2-hydroxypropanamide |
| SMILES | CC(NCC(O)C(N)=O)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C12H16F2N2O3/c1-7(16-6-10(17)11(15)18)8-2-4-9(5-3-8)19-12(13)14/h2-5,7,10,12,16-17H,6H2,1H3,(H2,15,18) |
| InChIKey | VYAZDTOEOHOJHI-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |