C7H14N2O4S — CID 106172340
3-(1,1-dioxothiazinan-2-yl)-2-hydroxypropanamide (PubChem CID 106172340) has the molecular formula C7H14N2O4S and a molecular weight of 222.27 g/mol. Its IUPAC name is 3-(1,1-dioxothiazinan-2-yl)-2-hydroxypropanamide.
| Compound Name | 3-(1,1-dioxothiazinan-2-yl)-2-hydroxypropanamide |
|---|---|
| PubChem CID | 106172340 |
| Molecular Formula | C7H14N2O4S |
| Molecular Weight | 222.27 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | 3-(1,1-dioxothiazinan-2-yl)-2-hydroxypropanamide |
| SMILES | NC(=O)C(O)CN1CCCCS1(=O)=O |
| InChI | InChI=1S/C7H14N2O4S/c8-7(11)6(10)5-9-3-1-2-4-14(9,12)13/h6,10H,1-5H2,(H2,8,11) |
| InChIKey | CZJXKLDAYUNHDV-UHFFFAOYSA-N |
| XLogP | -1.74 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.27 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |