C13H19NO2 — CID 106173893
2-[2-(cyclopenten-1-yl)ethylamino]-1-(furan-2-yl)ethanol (PubChem CID 106173893) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is 2-[2-(cyclopenten-1-yl)ethylamino]-1-(furan-2-yl)ethanol.
| Compound Name | 2-[2-(cyclopenten-1-yl)ethylamino]-1-(furan-2-yl)ethanol |
|---|---|
| PubChem CID | 106173893 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 2-[2-(cyclopenten-1-yl)ethylamino]-1-(furan-2-yl)ethanol |
| SMILES | OC(CNCCC1=CCCC1)c1ccco1 |
| InChI | InChI=1S/C13H19NO2/c15-12(13-6-3-9-16-13)10-14-8-7-11-4-1-2-5-11/h3-4,6,9,12,14-15H,1-2,5,7-8,10H2 |
| InChIKey | DMVVLVSFODRASQ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 45.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|