C12H17N3O4 — CID 106174657
2-hydroxy-3-[[2-(4-methoxyanilino)-2-oxoethyl]amino]propanamide (PubChem CID 106174657) has the molecular formula C12H17N3O4 and a molecular weight of 267.29 g/mol. Its IUPAC name is 2-hydroxy-3-[[2-(4-methoxyanilino)-2-oxoethyl]amino]propanamide.
| Compound Name | 2-hydroxy-3-[[2-(4-methoxyanilino)-2-oxoethyl]amino]propanamide |
|---|---|
| PubChem CID | 106174657 |
| Molecular Formula | C12H17N3O4 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | 2-hydroxy-3-[[2-(4-methoxyanilino)-2-oxoethyl]amino]propanamide |
| SMILES | COc1ccc(NC(=O)CNCC(O)C(N)=O)cc1 |
| InChI | InChI=1S/C12H17N3O4/c1-19-9-4-2-8(3-5-9)15-11(17)7-14-6-10(16)12(13)18/h2-5,10,14,16H,6-7H2,1H3,(H2,13,18)(H,15,17) |
| InChIKey | WHZXRCDHROHZLG-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |