C19H24NO3P — CID 10617498
(3S,5R)-4-benzyl-3-ethyl-2-methoxy-5-phenyl-1,4,2lambda5-oxazaphosphinane 2-oxide (PubChem CID 10617498) has the molecular formula C19H24NO3P and a molecular weight of 345.38 g/mol. Its IUPAC name is (3S,5R)-4-benzyl-3-ethyl-2-methoxy-5-phenyl-1,4,2lambda5-oxazaphosphinane 2-oxide.
| Compound Name | (3S,5R)-4-benzyl-3-ethyl-2-methoxy-5-phenyl-1,4,2lambda5-oxazaphosphinane 2-oxide |
|---|---|
| PubChem CID | 10617498 |
| Molecular Formula | C19H24NO3P |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | (3S,5R)-4-benzyl-3-ethyl-2-methoxy-5-phenyl-1,4,2lambda5-oxazaphosphinane 2-oxide |
| SMILES | CC[C@H]1N(Cc2ccccc2)[C@H](c2ccccc2)COP1(=O)OC |
| InChI | InChI=1S/C19H24NO3P/c1-3-19-20(14-16-10-6-4-7-11-16)18(15-23-24(19,21)22-2)17-12-8-5-9-13-17/h4-13,18-19H,3,14-15H2,1-2H3/t18-,19-,24?/m0/s1 |
| InChIKey | FASBCJDCRSYODI-QHEXFSSWSA-N |
| XLogP | 4.84 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|