C11H21N3O4 — CID 106175544
N-(3-amino-2-hydroxy-3-oxopropyl)-4-(propylamino)oxolane-3-carboxamide (PubChem CID 106175544) has the molecular formula C11H21N3O4 and a molecular weight of 259.31 g/mol. Its IUPAC name is N-(3-amino-2-hydroxy-3-oxopropyl)-4-(propylamino)oxolane-3-carboxamide.
| Compound Name | N-(3-amino-2-hydroxy-3-oxopropyl)-4-(propylamino)oxolane-3-carboxamide |
|---|---|
| PubChem CID | 106175544 |
| Molecular Formula | C11H21N3O4 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.15 |
| IUPAC Name | N-(3-amino-2-hydroxy-3-oxopropyl)-4-(propylamino)oxolane-3-carboxamide |
| SMILES | CCCNC1COCC1C(=O)NCC(O)C(N)=O |
| InChI | InChI=1S/C11H21N3O4/c1-2-3-13-8-6-18-5-7(8)11(17)14-4-9(15)10(12)16/h7-9,13,15H,2-6H2,1H3,(H2,12,16)(H,14,17) |
| InChIKey | MWMVMGSJPPCVCY-UHFFFAOYSA-N |
| XLogP | -2.04 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | -2.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |