C8H15N3O3 — CID 106175617
N-(3-amino-2-hydroxy-3-oxopropyl)-1-(aminomethyl)cyclopropane-1-carboxamide (PubChem CID 106175617) has the molecular formula C8H15N3O3 and a molecular weight of 201.23 g/mol. Its IUPAC name is N-(3-amino-2-hydroxy-3-oxopropyl)-1-(aminomethyl)cyclopropane-1-carboxamide.
| Compound Name | N-(3-amino-2-hydroxy-3-oxopropyl)-1-(aminomethyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 106175617 |
| Molecular Formula | C8H15N3O3 |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.11 |
| IUPAC Name | N-(3-amino-2-hydroxy-3-oxopropyl)-1-(aminomethyl)cyclopropane-1-carboxamide |
| SMILES | NCC1(C(=O)NCC(O)C(N)=O)CC1 |
| InChI | InChI=1S/C8H15N3O3/c9-4-8(1-2-8)7(14)11-3-5(12)6(10)13/h5,12H,1-4,9H2,(H2,10,13)(H,11,14) |
| InChIKey | JNHPJPOIWZWMPE-UHFFFAOYSA-N |
| XLogP | -2.31 |
| TPSA | 118.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | -2.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |