C8H15N3O2 — CID 80588317
1-(aminomethyl)-N-(3-amino-3-oxopropyl)cyclopropane-1-carboxamide (PubChem CID 80588317) has the molecular formula C8H15N3O2 and a molecular weight of 185.23 g/mol. Its IUPAC name is 1-(aminomethyl)-N-(3-amino-3-oxopropyl)cyclopropane-1-carboxamide.
| Compound Name | 1-(aminomethyl)-N-(3-amino-3-oxopropyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 80588317 |
| Molecular Formula | C8H15N3O2 |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | 1-(aminomethyl)-N-(3-amino-3-oxopropyl)cyclopropane-1-carboxamide |
| SMILES | NCC1(C(=O)NCCC(N)=O)CC1 |
| InChI | InChI=1S/C8H15N3O2/c9-5-8(2-3-8)7(13)11-4-1-6(10)12/h1-5,9H2,(H2,10,12)(H,11,13) |
| InChIKey | HSWIPAVBZZSRIF-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |