C15H24FNO3 — CID 106175670
3-[[3-(4-fluorophenoxy)-2-hydroxypropyl]amino]-3-methylpentan-1-ol (PubChem CID 106175670) has the molecular formula C15H24FNO3 and a molecular weight of 285.36 g/mol. Its IUPAC name is 3-[[3-(4-fluorophenoxy)-2-hydroxypropyl]amino]-3-methylpentan-1-ol.
| Compound Name | 3-[[3-(4-fluorophenoxy)-2-hydroxypropyl]amino]-3-methylpentan-1-ol |
|---|---|
| PubChem CID | 106175670 |
| Molecular Formula | C15H24FNO3 |
| Molecular Weight | 285.36 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 3-[[3-(4-fluorophenoxy)-2-hydroxypropyl]amino]-3-methylpentan-1-ol |
| SMILES | CCC(C)(CCO)NCC(O)COc1ccc(F)cc1 |
| InChI | InChI=1S/C15H24FNO3/c1-3-15(2,8-9-18)17-10-13(19)11-20-14-6-4-12(16)5-7-14/h4-7,13,17-19H,3,8-11H2,1-2H3 |
| InChIKey | HXRGHNZWYIHKHE-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.36 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |