C14H29F2NO3 — CID 106175962
2,2-difluoro-3-[(2-hydroxy-3-octoxypropyl)amino]propan-1-ol (PubChem CID 106175962) has the molecular formula C14H29F2NO3 and a molecular weight of 297.39 g/mol. Its IUPAC name is 2,2-difluoro-3-[(2-hydroxy-3-octoxypropyl)amino]propan-1-ol.
| Compound Name | 2,2-difluoro-3-[(2-hydroxy-3-octoxypropyl)amino]propan-1-ol |
|---|---|
| PubChem CID | 106175962 |
| Molecular Formula | C14H29F2NO3 |
| Molecular Weight | 297.39 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | 2,2-difluoro-3-[(2-hydroxy-3-octoxypropyl)amino]propan-1-ol |
| SMILES | CCCCCCCCOCC(O)CNCC(F)(F)CO |
| InChI | InChI=1S/C14H29F2NO3/c1-2-3-4-5-6-7-8-20-10-13(19)9-17-11-14(15,16)12-18/h13,17-19H,2-12H2,1H3 |
| InChIKey | AKILZVLSGFHXER-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.39 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|