C12H22F2N2O2 — CID 106176276
N-cycloheptyl-2-[(2,2-difluoro-3-hydroxypropyl)amino]acetamide (PubChem CID 106176276) has the molecular formula C12H22F2N2O2 and a molecular weight of 264.32 g/mol. Its IUPAC name is N-cycloheptyl-2-[(2,2-difluoro-3-hydroxypropyl)amino]acetamide.
| Compound Name | N-cycloheptyl-2-[(2,2-difluoro-3-hydroxypropyl)amino]acetamide |
|---|---|
| PubChem CID | 106176276 |
| Molecular Formula | C12H22F2N2O2 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | N-cycloheptyl-2-[(2,2-difluoro-3-hydroxypropyl)amino]acetamide |
| SMILES | O=C(CNCC(F)(F)CO)NC1CCCCCC1 |
| InChI | InChI=1S/C12H22F2N2O2/c13-12(14,9-17)8-15-7-11(18)16-10-5-3-1-2-4-6-10/h10,15,17H,1-9H2,(H,16,18) |
| InChIKey | HTAGSRITJJVPLH-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |