C11H19F3N2O — CID 113327343
N-cyclopentyl-2-(4,4,4-trifluorobutylamino)acetamide (PubChem CID 113327343) has the molecular formula C11H19F3N2O and a molecular weight of 252.28 g/mol. Its IUPAC name is N-cyclopentyl-2-(4,4,4-trifluorobutylamino)acetamide.
| Compound Name | N-cyclopentyl-2-(4,4,4-trifluorobutylamino)acetamide |
|---|---|
| PubChem CID | 113327343 |
| Molecular Formula | C11H19F3N2O |
| Molecular Weight | 252.28 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | N-cyclopentyl-2-(4,4,4-trifluorobutylamino)acetamide |
| SMILES | O=C(CNCCCC(F)(F)F)NC1CCCC1 |
| InChI | InChI=1S/C11H19F3N2O/c12-11(13,14)6-3-7-15-8-10(17)16-9-4-1-2-5-9/h9,15H,1-8H2,(H,16,17) |
| InChIKey | AYNRFKCGNXQEDF-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.28 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|