C10H20F2N2O2 — CID 106176663
6-amino-N-(2,2-difluoro-3-hydroxypropyl)-4-methylhexanamide (PubChem CID 106176663) has the molecular formula C10H20F2N2O2 and a molecular weight of 238.28 g/mol. Its IUPAC name is 6-amino-N-(2,2-difluoro-3-hydroxypropyl)-4-methylhexanamide.
| Compound Name | 6-amino-N-(2,2-difluoro-3-hydroxypropyl)-4-methylhexanamide |
|---|---|
| PubChem CID | 106176663 |
| Molecular Formula | C10H20F2N2O2 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | 6-amino-N-(2,2-difluoro-3-hydroxypropyl)-4-methylhexanamide |
| SMILES | CC(CCN)CCC(=O)NCC(F)(F)CO |
| InChI | InChI=1S/C10H20F2N2O2/c1-8(4-5-13)2-3-9(16)14-6-10(11,12)7-15/h8,15H,2-7,13H2,1H3,(H,14,16) |
| InChIKey | VCPZDKOBNBADRD-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |