C9H16F2N2O2 — CID 106176675
(3S)-N-(2,2-difluoro-3-hydroxypropyl)piperidine-3-carboxamide (PubChem CID 106176675) has the molecular formula C9H16F2N2O2 and a molecular weight of 222.23 g/mol. Its IUPAC name is (3S)-N-(2,2-difluoro-3-hydroxypropyl)piperidine-3-carboxamide.
| Compound Name | (3S)-N-(2,2-difluoro-3-hydroxypropyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 106176675 |
| Molecular Formula | C9H16F2N2O2 |
| Molecular Weight | 222.23 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | (3S)-N-(2,2-difluoro-3-hydroxypropyl)piperidine-3-carboxamide |
| SMILES | O=C(NCC(F)(F)CO)[C@H]1CCCNC1 |
| InChI | InChI=1S/C9H16F2N2O2/c10-9(11,6-14)5-13-8(15)7-2-1-3-12-4-7/h7,12,14H,1-6H2,(H,13,15)/t7-/m0/s1 |
| InChIKey | NOPILUFUVZRKRZ-ZETCQYMHSA-N |
| XLogP | -0.27 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.23 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |