C9H13F5N2O — CID 162568495
N-(2,2,3,3,3-pentafluoropropyl)piperidine-3-carboxamide (PubChem CID 162568495) has the molecular formula C9H13F5N2O and a molecular weight of 260.21 g/mol. Its IUPAC name is N-(2,2,3,3,3-pentafluoropropyl)piperidine-3-carboxamide.
| Compound Name | N-(2,2,3,3,3-pentafluoropropyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 162568495 |
| Molecular Formula | C9H13F5N2O |
| Molecular Weight | 260.21 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | N-(2,2,3,3,3-pentafluoropropyl)piperidine-3-carboxamide |
| SMILES | O=C(NCC(F)(F)C(F)(F)F)C1CCCNC1 |
| InChI | InChI=1S/C9H13F5N2O/c10-8(11,9(12,13)14)5-16-7(17)6-2-1-3-15-4-6/h6,15H,1-5H2,(H,16,17) |
| InChIKey | NNBQAYFUNZOHFC-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.21 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|