C11H16ClN3O3 — CID 106178760
3-[(6-chloro-3-nitro-2-pyridinyl)amino]-3-methylpentan-1-ol (PubChem CID 106178760) has the molecular formula C11H16ClN3O3 and a molecular weight of 273.72 g/mol. Its IUPAC name is 3-[(6-chloro-3-nitro-2-pyridinyl)amino]-3-methylpentan-1-ol.
| Compound Name | 3-[(6-chloro-3-nitro-2-pyridinyl)amino]-3-methylpentan-1-ol |
|---|---|
| PubChem CID | 106178760 |
| Molecular Formula | C11H16ClN3O3 |
| Molecular Weight | 273.72 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 3-[(6-chloro-3-nitro-2-pyridinyl)amino]-3-methylpentan-1-ol |
| SMILES | CCC(C)(CCO)Nc1nc(Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H16ClN3O3/c1-3-11(2,6-7-16)14-10-8(15(17)18)4-5-9(12)13-10/h4-5,16H,3,6-7H2,1-2H3,(H,13,14) |
| InChIKey | YNDYKLARGBTRCA-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 88.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.72 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|