C15H24N2O4 — CID 106180328
N-(1-amino-3-methoxypropan-2-yl)-3,4-diethoxybenzamide (PubChem CID 106180328) has the molecular formula C15H24N2O4 and a molecular weight of 296.37 g/mol. Its IUPAC name is N-(1-amino-3-methoxypropan-2-yl)-3,4-diethoxybenzamide.
| Compound Name | N-(1-amino-3-methoxypropan-2-yl)-3,4-diethoxybenzamide |
|---|---|
| PubChem CID | 106180328 |
| Molecular Formula | C15H24N2O4 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | N-(1-amino-3-methoxypropan-2-yl)-3,4-diethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)NC(CN)COC)cc1OCC |
| InChI | InChI=1S/C15H24N2O4/c1-4-20-13-7-6-11(8-14(13)21-5-2)15(18)17-12(9-16)10-19-3/h6-8,12H,4-5,9-10,16H2,1-3H3,(H,17,18) |
| InChIKey | BGIRLMBJLPTXQG-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |