C9H12BrClN2O — CID 106181473
5-bromo-N-(1-chloro-3-methoxypropan-2-yl)pyridin-2-amine (PubChem CID 106181473) has the molecular formula C9H12BrClN2O and a molecular weight of 279.56 g/mol. Its IUPAC name is 5-bromo-N-(1-chloro-3-methoxypropan-2-yl)pyridin-2-amine.
| Compound Name | 5-bromo-N-(1-chloro-3-methoxypropan-2-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 106181473 |
| Molecular Formula | C9H12BrClN2O |
| Molecular Weight | 279.56 g/mol |
| Exact Mass | 277.98 |
| IUPAC Name | 5-bromo-N-(1-chloro-3-methoxypropan-2-yl)pyridin-2-amine |
| SMILES | COCC(CCl)Nc1ccc(Br)cn1 |
| InChI | InChI=1S/C9H12BrClN2O/c1-14-6-8(4-11)13-9-3-2-7(10)5-12-9/h2-3,5,8H,4,6H2,1H3,(H,12,13) |
| InChIKey | LUCASUDVTKDXCL-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.56 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|