C14H29NO — CID 106185254
3-[(3,5-dimethylcyclohexyl)amino]-2,3-dimethylbutan-2-ol (PubChem CID 106185254) has the molecular formula C14H29NO and a molecular weight of 227.39 g/mol. Its IUPAC name is 3-[(3,5-dimethylcyclohexyl)amino]-2,3-dimethylbutan-2-ol.
| Compound Name | 3-[(3,5-dimethylcyclohexyl)amino]-2,3-dimethylbutan-2-ol |
|---|---|
| PubChem CID | 106185254 |
| Molecular Formula | C14H29NO |
| Molecular Weight | 227.39 g/mol |
| Exact Mass | 227.22 |
| IUPAC Name | 3-[(3,5-dimethylcyclohexyl)amino]-2,3-dimethylbutan-2-ol |
| SMILES | CC1CC(C)CC(NC(C)(C)C(C)(C)O)C1 |
| InChI | InChI=1S/C14H29NO/c1-10-7-11(2)9-12(8-10)15-13(3,4)14(5,6)16/h10-12,15-16H,7-9H2,1-6H3 |
| InChIKey | RWYGYAVEMWBBJQ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.39 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |