About 6-[(3-hydroxy-2,3-dimethylbutan-2-yl)amino]pyridazine-3-carboxamide
6-[(3-hydroxy-2,3-dimethylbutan-2-yl)amino]pyridazine-3-carboxamide (PubChem CID 106185340) has the molecular formula C11H18N4O2
and a molecular weight of 238.29 g/mol. Its IUPAC name is 6-[(3-hydroxy-2,3-dimethylbutan-2-yl)amino]pyridazine-3-carboxamide.
Molecular Properties
| Compound Name | 6-[(3-hydroxy-2,3-dimethylbutan-2-yl)amino]pyridazine-3-carboxamide |
| PubChem CID | 106185340 |
| Molecular Formula | C11H18N4O2 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | 6-[(3-hydroxy-2,3-dimethylbutan-2-yl)amino]pyridazine-3-carboxamide |
| SMILES | CC(C)(O)C(C)(C)Nc1ccc(C(N)=O)nn1 |
| InChI | InChI=1S/C11H18N4O2/c1-10(2,11(3,4)17)13-8-6-5-7(9(12)16)14-15-8/h5-6,17H,1-4H3,(H2,12,16)(H,13,15) |
| InChIKey | SPEOIMICGATYDL-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 101.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-[(3-hydroxy-2,3-dimethylbutan-2-yl)amino]pyridazine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(3-hydroxy-2,3-dimethylbutan-2-yl)amino]pyridazine-3-carboxamide?
The IUPAC name of 6-[(3-hydroxy-2,3-dimethylbutan-2-yl)amino]pyridazine-3-carboxamide (CID 106185340) is 6-[(3-hydroxy-2,3-dimethylbutan-2-yl)amino]pyridazine-3-carboxamide.
What is the SMILES notation for 6-[(3-hydroxy-2,3-dimethylbutan-2-yl)amino]pyridazine-3-carboxamide?
The canonical SMILES for 6-[(3-hydroxy-2,3-dimethylbutan-2-yl)amino]pyridazine-3-carboxamide is CC(C)(O)C(C)(C)Nc1ccc(C(N)=O)nn1.
What is the InChIKey of 6-[(3-hydroxy-2,3-dimethylbutan-2-yl)amino]pyridazine-3-carboxamide?
The InChIKey is SPEOIMICGATYDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N4O2/c1-10(2,11(3,4)17)13-8-6-5-7(9(12)16)14-15-8/h5-6,17H,1-4H3,(H2,12,16)(H,13,15).
What are the key properties of 6-[(3-hydroxy-2,3-dimethylbutan-2-yl)amino]pyridazine-3-carboxamide?
6-[(3-hydroxy-2,3-dimethylbutan-2-yl)amino]pyridazine-3-carboxamide has a molecular weight of 238.29 g/mol, XLogP of 0.54, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(3-hydroxy-2,3-dimethylbutan-2-yl)amino]pyridazine-3-carboxamide is sourced from PubChem (CID 106185340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).