C16H25NO — CID 106185527
3-[(4-cyclopropylphenyl)methylamino]-2,3-dimethylbutan-2-ol (PubChem CID 106185527) has the molecular formula C16H25NO and a molecular weight of 247.38 g/mol. Its IUPAC name is 3-[(4-cyclopropylphenyl)methylamino]-2,3-dimethylbutan-2-ol.
| Compound Name | 3-[(4-cyclopropylphenyl)methylamino]-2,3-dimethylbutan-2-ol |
|---|---|
| PubChem CID | 106185527 |
| Molecular Formula | C16H25NO |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | 3-[(4-cyclopropylphenyl)methylamino]-2,3-dimethylbutan-2-ol |
| SMILES | CC(C)(O)C(C)(C)NCc1ccc(C2CC2)cc1 |
| InChI | InChI=1S/C16H25NO/c1-15(2,16(3,4)18)17-11-12-5-7-13(8-6-12)14-9-10-14/h5-8,14,17-18H,9-11H2,1-4H3 |
| InChIKey | LEPIJVRCKYGIHR-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |