C12H24N2O2 — CID 106187583
2-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-ylamino)-3-methoxypropan-1-ol (PubChem CID 106187583) has the molecular formula C12H24N2O2 and a molecular weight of 228.34 g/mol. Its IUPAC name is 2-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-ylamino)-3-methoxypropan-1-ol.
| Compound Name | 2-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-ylamino)-3-methoxypropan-1-ol |
|---|---|
| PubChem CID | 106187583 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | 2-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-ylamino)-3-methoxypropan-1-ol |
| SMILES | COCC(CO)NC1CCN2CCCCC12 |
| InChI | InChI=1S/C12H24N2O2/c1-16-9-10(8-15)13-11-5-7-14-6-3-2-4-12(11)14/h10-13,15H,2-9H2,1H3 |
| InChIKey | AMWRMOAVHWMHRN-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |