C12H15ClN2O2 — CID 106188035
4-[3-(2-chloroacetyl)-2,5-dimethylpyrrol-1-yl]pyrrolidin-2-one (PubChem CID 106188035) has the molecular formula C12H15ClN2O2 and a molecular weight of 254.72 g/mol. Its IUPAC name is 4-[3-(2-chloroacetyl)-2,5-dimethylpyrrol-1-yl]pyrrolidin-2-one.
| Compound Name | 4-[3-(2-chloroacetyl)-2,5-dimethylpyrrol-1-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 106188035 |
| Molecular Formula | C12H15ClN2O2 |
| Molecular Weight | 254.72 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | 4-[3-(2-chloroacetyl)-2,5-dimethylpyrrol-1-yl]pyrrolidin-2-one |
| SMILES | Cc1cc(C(=O)CCl)c(C)n1C1CNC(=O)C1 |
| InChI | InChI=1S/C12H15ClN2O2/c1-7-3-10(11(16)5-13)8(2)15(7)9-4-12(17)14-6-9/h3,9H,4-6H2,1-2H3,(H,14,17) |
| InChIKey | FIRVDYBONALNBM-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.72 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|